C21H24O5 — CID 57247404
2-hydroxy-1-[(11S,13S,14S,16S,17R)-3,11,17-trihydroxy-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 57247404) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-hydroxy-1-[(11S,13S,14S,16S,17R)-3,11,17-trihydroxy-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(11S,13S,14S,16S,17R)-3,11,17-trihydroxy-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 57247404 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-hydroxy-1-[(11S,13S,14S,16S,17R)-3,11,17-trihydroxy-13,16-dimethyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@H]1C[C@H]2c3ccc4cc(O)ccc4c3[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C21H24O5/c1-11-7-16-15-5-3-12-8-13(23)4-6-14(12)19(15)17(24)9-20(16,2)21(11,26)18(25)10-22/h3-6,8,11,16-17,22-24,26H,7,9-10H2,1-2H3/t11-,16-,17-,20-,21-/m0/s1 |
| InChIKey | JPCBQSKVHMQVEE-VUUGTFFYSA-N |
| XLogP | 2.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |