About 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one
2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one (PubChem CID 57247500) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one |
| PubChem CID | 57247500 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one |
| SMILES | O=C1CC(O)C=C1CC=CCCCC(O)CO |
| InChI | InChI=1S/C13H20O4/c14-9-11(15)6-4-2-1-3-5-10-7-12(16)8-13(10)17/h1,3,7,11-12,14-16H,2,4-6,8-9H2 |
| InChIKey | FOBINALFELGVDE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one?
The IUPAC name of 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one (CID 57247500) is 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one.
What is the SMILES notation for 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one?
The canonical SMILES for 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one is O=C1CC(O)C=C1CC=CCCCC(O)CO.
What is the InChIKey of 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one?
The InChIKey is FOBINALFELGVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c14-9-11(15)6-4-2-1-3-5-10-7-12(16)8-13(10)17/h1,3,7,11-12,14-16H,2,4-6,8-9H2.
What are the key properties of 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one?
2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one has a molecular weight of 240.30 g/mol, XLogP of 0.72, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,8-dihydroxyoct-2-enyl)-4-hydroxycyclopent-2-en-1-one is sourced from PubChem (CID 57247500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).