C19H30ClN2O5S+ — CID 57247596
[4-chloro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate (PubChem CID 57247596) has the molecular formula C19H30ClN2O5S+ and a molecular weight of 433.98 g/mol. Its IUPAC name is [4-chloro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-chloro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57247596 |
| Molecular Formula | C19H30ClN2O5S+ |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [4-chloro-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-ium-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[N+]2(CCNC(=O)OC(C)(C)C)CCC(Cl)CC2)cc1 |
| InChI | InChI=1S/C19H29ClN2O5S/c1-15-5-7-17(8-6-15)28(24,25)27-22(12-9-16(20)10-13-22)14-11-21-18(23)26-19(2,3)4/h5-8,16H,9-14H2,1-4H3/p+1 |
| InChIKey | YAMFWBMNDBCLSB-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|