About 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine
1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine (PubChem CID 57248057) has the molecular formula C12H24N3+
and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine |
| PubChem CID | 57248057 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine |
| SMILES | CCCCC=CC[N+]1(C(C)N)C=NCC1 |
| InChI | InChI=1S/C12H24N3/c1-3-4-5-6-7-9-15(12(2)13)10-8-14-11-15/h6-7,11-12H,3-5,8-10,13H2,1-2H3/q+1 |
| InChIKey | WHOCCAPHMSJYHD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The IUPAC name of 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine (CID 57248057) is 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine.
What is the SMILES notation for 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The canonical SMILES for 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine is CCCCC=CC[N+]1(C(C)N)C=NCC1.
What is the InChIKey of 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
The InChIKey is WHOCCAPHMSJYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N3/c1-3-4-5-6-7-9-15(12(2)13)10-8-14-11-15/h6-7,11-12H,3-5,8-10,13H2,1-2H3/q+1.
What are the key properties of 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine?
1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine has a molecular weight of 210.34 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hept-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethanamine is sourced from PubChem (CID 57248057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).