About 1,2,2,3-tetrabromoadamantane
1,2,2,3-tetrabromoadamantane (PubChem CID 57248086) has the molecular formula C10H12Br4
and a molecular weight of 451.82 g/mol. Its IUPAC name is 1,2,2,3-tetrabromoadamantane.
Molecular Properties
| Compound Name | 1,2,2,3-tetrabromoadamantane |
| PubChem CID | 57248086 |
| Molecular Formula | C10H12Br4 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 447.77 |
| IUPAC Name | 1,2,2,3-tetrabromoadamantane |
| SMILES | BrC12CC3CC(C1)CC(Br)(C3)C2(Br)Br |
| InChI | InChI=1S/C10H12Br4/c11-8-2-6-1-7(4-8)5-9(12,3-6)10(8,13)14/h6-7H,1-5H2 |
| InChIKey | RVDSNHLUZAIOFS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2,3-tetrabromoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2,3-tetrabromoadamantane?
The IUPAC name of 1,2,2,3-tetrabromoadamantane (CID 57248086) is 1,2,2,3-tetrabromoadamantane.
What is the SMILES notation for 1,2,2,3-tetrabromoadamantane?
The canonical SMILES for 1,2,2,3-tetrabromoadamantane is BrC12CC3CC(C1)CC(Br)(C3)C2(Br)Br.
What is the InChIKey of 1,2,2,3-tetrabromoadamantane?
The InChIKey is RVDSNHLUZAIOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br4/c11-8-2-6-1-7(4-8)5-9(12,3-6)10(8,13)14/h6-7H,1-5H2.
What are the key properties of 1,2,2,3-tetrabromoadamantane?
1,2,2,3-tetrabromoadamantane has a molecular weight of 451.82 g/mol, XLogP of 4.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,3-tetrabromoadamantane is sourced from PubChem (CID 57248086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).