About (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol
(4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol (PubChem CID 57248970) has the molecular formula C16H17NO2S
and a molecular weight of 287.38 g/mol. Its IUPAC name is (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol.
Molecular Properties
| Compound Name | (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol |
| PubChem CID | 57248970 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol |
| SMILES | CSc1ccc([C@H]2CC=Cc3c2c(O)n(C)c3O)cc1 |
| InChI | InChI=1S/C16H17NO2S/c1-17-15(18)13-5-3-4-12(14(13)16(17)19)10-6-8-11(20-2)9-7-10/h3,5-9,12,18-19H,4H2,1-2H3/t12-/m1/s1 |
| InChIKey | VFEVEWUOJWLKIS-GFCCVEGCSA-N |
| XLogP | 3.71 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol?
The IUPAC name of (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol (CID 57248970) is (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol.
What is the SMILES notation for (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol?
The canonical SMILES for (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol is CSc1ccc([C@H]2CC=Cc3c2c(O)n(C)c3O)cc1.
What is the InChIKey of (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol?
The InChIKey is VFEVEWUOJWLKIS-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17NO2S/c1-17-15(18)13-5-3-4-12(14(13)16(17)19)10-6-8-11(20-2)9-7-10/h3,5-9,12,18-19H,4H2,1-2H3/t12-/m1/s1.
What are the key properties of (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol?
(4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol has a molecular weight of 287.38 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-methyl-4-(4-methylsulfanylphenyl)-4,5-dihydroisoindole-1,3-diol is sourced from PubChem (CID 57248970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).