2,3-diethyl-3-propylmorpholine

C11H23NO — CID 57248978

IUPAC2,3-diethyl-3-propylmorpholine
SMILESCCCC1(CC)NCCOC1CC
InChIInChI=1S/C11H23NO/c1-4-7-11(6-3)10(5-2)13-9-8-12-11/h10,12H,4-9H2,1-3H3
InChIKeyGOPMHQGOJIRIJG-UHFFFAOYSA-N
MW185.31 g/mol
LogP2.33
Rot. Bonds4

About 2,3-diethyl-3-propylmorpholine

2,3-diethyl-3-propylmorpholine (PubChem CID 57248978) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2,3-diethyl-3-propylmorpholine.

Molecular Properties

Compound Name2,3-diethyl-3-propylmorpholine
PubChem CID57248978
Molecular FormulaC11H23NO
Molecular Weight185.31 g/mol
Exact Mass185.18
IUPAC Name2,3-diethyl-3-propylmorpholine
SMILESCCCC1(CC)NCCOC1CC
InChIInChI=1S/C11H23NO/c1-4-7-11(6-3)10(5-2)13-9-8-12-11/h10,12H,4-9H2,1-3H3
InChIKeyGOPMHQGOJIRIJG-UHFFFAOYSA-N
XLogP2.33
TPSA21.26 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.31
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,3-diethyl-3-propylmorpholine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 20811826
CID 20811826
CID 22689145
CID 22689145
CID 28064342
CID 28064342
CID 22689127
CID 22689127
CID 55262469
CID 55262469
CID 28064247
CID 28064247
CID 168025493
CID 168025493
CID 168025500
CID 168025500
CID 18331948
CID 18331948
CID 19604002
CID 19604002
CID 19604010
CID 19604010
CID 19828889
CID 19828889

Frequently Asked Questions

What is the IUPAC name of 2,3-diethyl-3-propylmorpholine?
The IUPAC name of 2,3-diethyl-3-propylmorpholine (CID 57248978) is 2,3-diethyl-3-propylmorpholine.
What is the SMILES notation for 2,3-diethyl-3-propylmorpholine?
The canonical SMILES for 2,3-diethyl-3-propylmorpholine is CCCC1(CC)NCCOC1CC.
What is the InChIKey of 2,3-diethyl-3-propylmorpholine?
The InChIKey is GOPMHQGOJIRIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-4-7-11(6-3)10(5-2)13-9-8-12-11/h10,12H,4-9H2,1-3H3.
What are the key properties of 2,3-diethyl-3-propylmorpholine?
2,3-diethyl-3-propylmorpholine has a molecular weight of 185.31 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethyl-3-propylmorpholine is sourced from PubChem (CID 57248978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).