About 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide
3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide (PubChem CID 57249072) has the molecular formula C17H30N2O4
and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide.
Molecular Properties
| Compound Name | 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide |
| PubChem CID | 57249072 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide |
| SMILES | CC(=O)CC(=O)NCCC(C)CC(C)(C)CNC(=O)CC(C)=O |
| InChI | InChI=1S/C17H30N2O4/c1-12(6-7-18-15(22)8-13(2)20)10-17(4,5)11-19-16(23)9-14(3)21/h12H,6-11H2,1-5H3,(H,18,22)(H,19,23) |
| InChIKey | HCTSNIMTTSWPAJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide?
The IUPAC name of 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide (CID 57249072) is 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide.
What is the SMILES notation for 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide?
The canonical SMILES for 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide is CC(=O)CC(=O)NCCC(C)CC(C)(C)CNC(=O)CC(C)=O.
What is the InChIKey of 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide?
The InChIKey is HCTSNIMTTSWPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O4/c1-12(6-7-18-15(22)8-13(2)20)10-17(4,5)11-19-16(23)9-14(3)21/h12H,6-11H2,1-5H3,(H,18,22)(H,19,23).
What are the key properties of 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide?
3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide has a molecular weight of 326.44 g/mol, XLogP of 1.62, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-N-[3,5,5-trimethyl-6-(3-oxobutanoylamino)hexyl]butanamide is sourced from PubChem (CID 57249072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).