C19H32NO4S+ — CID 57249344
(1S,4S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(cyclohexylmethyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57249344) has the molecular formula C19H32NO4S+ and a molecular weight of 370.54 g/mol. Its IUPAC name is (1S,4S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(cyclohexylmethyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S,4S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(cyclohexylmethyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57249344 |
| Molecular Formula | C19H32NO4S+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1S,4S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-(cyclohexylmethyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)[N@+]1(C(=O)O)C[C@@H](CC2CCCCC2)CC1C |
| InChI | InChI=1S/C19H31NO4S/c1-13(12-25-15(3)21)18(22)20(19(23)24)11-17(9-14(20)2)10-16-7-5-4-6-8-16/h13-14,16-17H,4-12H2,1-3H3/p+1/t13?,14?,17-,20+/m1/s1 |
| InChIKey | GLFVVYGLVNGABH-REDJGORVSA-O |
| XLogP | 4.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|