About 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide
2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide (PubChem CID 57249346) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide |
| PubChem CID | 57249346 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide |
| SMILES | CC=C(C)C=CNC(=O)C(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-9(4)6-7-11-10(12)8(2)3/h5-8H,1-4H3,(H,11,12) |
| InChIKey | HSXUXFCOUPUHNB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide?
The IUPAC name of 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide (CID 57249346) is 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide.
What is the SMILES notation for 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide?
The canonical SMILES for 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide is CC=C(C)C=CNC(=O)C(C)C.
What is the InChIKey of 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide?
The InChIKey is HSXUXFCOUPUHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-5-9(4)6-7-11-10(12)8(2)3/h5-8H,1-4H3,(H,11,12).
What are the key properties of 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide?
2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide has a molecular weight of 167.25 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(3-methylpenta-1,3-dienyl)propanamide is sourced from PubChem (CID 57249346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).