About 4H-quinolizin-5-ium
4H-quinolizin-5-ium (PubChem CID 57249463) has the molecular formula C9H8N+
and a molecular weight of 130.17 g/mol. Its IUPAC name is 4H-quinolizin-5-ium.
Molecular Properties
| Compound Name | 4H-quinolizin-5-ium |
| PubChem CID | 57249463 |
| Molecular Formula | C9H8N+ |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 4H-quinolizin-5-ium |
| SMILES | C1=CC[n+]2ccccc2C=1 |
| InChI | InChI=1S/C9H8N/c1-3-7-10-8-4-2-6-9(10)5-1/h1,3-7H,8H2/q+1 |
| InChIKey | OYJGSLZHWZWQMA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4H-quinolizin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-quinolizin-5-ium?
The IUPAC name of 4H-quinolizin-5-ium (CID 57249463) is 4H-quinolizin-5-ium.
What is the SMILES notation for 4H-quinolizin-5-ium?
The canonical SMILES for 4H-quinolizin-5-ium is C1=CC[n+]2ccccc2C=1.
What is the InChIKey of 4H-quinolizin-5-ium?
The InChIKey is OYJGSLZHWZWQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N/c1-3-7-10-8-4-2-6-9(10)5-1/h1,3-7H,8H2/q+1.
What are the key properties of 4H-quinolizin-5-ium?
4H-quinolizin-5-ium has a molecular weight of 130.17 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-quinolizin-5-ium is sourced from PubChem (CID 57249463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).