C16H17NO7 — CID 57249492
1-[3-[[(1S,2R,4R,5S,6S)-1,5,6-trihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]oxy]indol-1-yl]ethanone (PubChem CID 57249492) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is 1-[3-[[(1S,2R,4R,5S,6S)-1,5,6-trihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]oxy]indol-1-yl]ethanone.
| Compound Name | 1-[3-[[(1S,2R,4R,5S,6S)-1,5,6-trihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]oxy]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 57249492 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[3-[[(1S,2R,4R,5S,6S)-1,5,6-trihydroxy-4-(hydroxymethyl)-3-oxabicyclo[3.1.0]hexan-2-yl]oxy]indol-1-yl]ethanone |
| SMILES | CC(=O)n1cc(O[C@H]2O[C@H](CO)[C@@]3(O)[C@H](O)[C@@]23O)c2ccccc21 |
| InChI | InChI=1S/C16H17NO7/c1-8(19)17-6-11(9-4-2-3-5-10(9)17)23-14-16(22)13(20)15(16,21)12(7-18)24-14/h2-6,12-14,18,20-22H,7H2,1H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | VZZXZYBHRJQMMU-LYYZXLFJSA-N |
| XLogP | -0.77 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |