C19H35NO4 — CID 57249839
tert-butyl N-[(2S,3R,4S)-1-(cyclohexen-1-yl)-3,4-dihydroxy-6-methylheptan-2-yl]carbamate (PubChem CID 57249839) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S)-1-(cyclohexen-1-yl)-3,4-dihydroxy-6-methylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S)-1-(cyclohexen-1-yl)-3,4-dihydroxy-6-methylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 57249839 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S)-1-(cyclohexen-1-yl)-3,4-dihydroxy-6-methylheptan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1=CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35NO4/c1-13(2)11-16(21)17(22)15(12-14-9-7-6-8-10-14)20-18(23)24-19(3,4)5/h9,13,15-17,21-22H,6-8,10-12H2,1-5H3,(H,20,23)/t15-,16-,17+/m0/s1 |
| InChIKey | GMVOSTKDEPRHNL-YESZJQIVSA-N |
| XLogP | 3.54 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|