C22H39NO — CID 57249930
(8S,9R,10S,13R,14S)-11-(dimethylamino)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 57249930) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-11-(dimethylamino)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9R,10S,13R,14S)-11-(dimethylamino)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57249930 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (8S,9R,10S,13R,14S)-11-(dimethylamino)-10,13,17-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1CC[C@H]2[C@@H]3CCC4CC(O)CC[C@]4(C)[C@@H]3C(N(C)C)C[C@]12C |
| InChI | InChI=1S/C22H39NO/c1-14-6-9-18-17-8-7-15-12-16(24)10-11-21(15,2)20(17)19(23(4)5)13-22(14,18)3/h14-20,24H,6-13H2,1-5H3/t14?,15?,16?,17-,18-,19?,20-,21-,22+/m0/s1 |
| InChIKey | GZTKKMUCJVERPD-FJXHOEQFSA-N |
| XLogP | 4.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |