C20H20BrClN2O — CID 57250038
[3-(5-bromopentylamino)-6-chloro-1H-indol-2-yl]-phenylmethanone (PubChem CID 57250038) has the molecular formula C20H20BrClN2O and a molecular weight of 419.75 g/mol. Its IUPAC name is [3-(5-bromopentylamino)-6-chloro-1H-indol-2-yl]-phenylmethanone.
| Compound Name | [3-(5-bromopentylamino)-6-chloro-1H-indol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57250038 |
| Molecular Formula | C20H20BrClN2O |
| Molecular Weight | 419.75 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | [3-(5-bromopentylamino)-6-chloro-1H-indol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1[nH]c2cc(Cl)ccc2c1NCCCCCBr |
| InChI | InChI=1S/C20H20BrClN2O/c21-11-5-2-6-12-23-18-16-10-9-15(22)13-17(16)24-19(18)20(25)14-7-3-1-4-8-14/h1,3-4,7-10,13,23-24H,2,5-6,11-12H2 |
| InChIKey | AGXPPHBKOUDXAJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|