C36H63N3O9S3 — CID 57250438
2-[3,5-bis[2-(3-hexylsulfanylpropanoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-hexylsulfanylpropanoate (PubChem CID 57250438) has the molecular formula C36H63N3O9S3 and a molecular weight of 778.11 g/mol. Its IUPAC name is 2-[3,5-bis[2-(3-hexylsulfanylpropanoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-hexylsulfanylpropanoate.
| Compound Name | 2-[3,5-bis[2-(3-hexylsulfanylpropanoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-hexylsulfanylpropanoate |
|---|---|
| PubChem CID | 57250438 |
| Molecular Formula | C36H63N3O9S3 |
| Molecular Weight | 778.11 g/mol |
| Exact Mass | 777.37 |
| IUPAC Name | 2-[3,5-bis[2-(3-hexylsulfanylpropanoyloxy)ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-hexylsulfanylpropanoate |
| SMILES | CCCCCCSCCC(=O)OCCn1c(=O)n(CCOC(=O)CCSCCCCCC)c(=O)n(CCOC(=O)CCSCCCCCC)c1=O |
| InChI | InChI=1S/C36H63N3O9S3/c1-4-7-10-13-25-49-28-16-31(40)46-22-19-37-34(43)38(20-23-47-32(41)17-29-50-26-14-11-8-5-2)36(45)39(35(37)44)21-24-48-33(42)18-30-51-27-15-12-9-6-3/h4-30H2,1-3H3 |
| InChIKey | RTPPQQHXPKGHGU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.11 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|