C24H34N2O3S — CID 57251164
2-propoxyethyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate (PubChem CID 57251164) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is 2-propoxyethyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate.
| Compound Name | 2-propoxyethyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 57251164 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-propoxyethyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
| SMILES | CCCOCCOC(=O)Nc1ccc2scc(C3CCC4CCCCN4CC3)c2c1 |
| InChI | InChI=1S/C24H34N2O3S/c1-2-13-28-14-15-29-24(27)25-19-7-9-23-21(16-19)22(17-30-23)18-6-8-20-5-3-4-11-26(20)12-10-18/h7,9,16-18,20H,2-6,8,10-15H2,1H3,(H,25,27) |
| InChIKey | BOHOTLPLOGPRCA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|