C15H32O6 — CID 57251180
7,7-bis(2-hydroxyethyl)-3-methyldecane-1,3,5,9-tetrol (PubChem CID 57251180) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is 7,7-bis(2-hydroxyethyl)-3-methyldecane-1,3,5,9-tetrol.
| Compound Name | 7,7-bis(2-hydroxyethyl)-3-methyldecane-1,3,5,9-tetrol |
|---|---|
| PubChem CID | 57251180 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 7,7-bis(2-hydroxyethyl)-3-methyldecane-1,3,5,9-tetrol |
| SMILES | CC(O)CC(CCO)(CCO)CC(O)CC(C)(O)CCO |
| InChI | InChI=1S/C15H32O6/c1-12(19)9-15(4-7-17,5-8-18)11-13(20)10-14(2,21)3-6-16/h12-13,16-21H,3-11H2,1-2H3 |
| InChIKey | KFXSAAQHYYCESR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |