C20H38O12P2 — CID 57251683
1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 57251683) has the molecular formula C20H38O12P2 and a molecular weight of 532.46 g/mol. Its IUPAC name is 1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | 1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 57251683 |
| Molecular Formula | C20H38O12P2 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]ethyl-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(P(=O)(O)OCOC(=O)C(C)(C)C)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38O12P2/c1-14(33(24,25)30-11-27-15(21)18(2,3)4)34(26,31-12-28-16(22)19(5,6)7)32-13-29-17(23)20(8,9)10/h14H,11-13H2,1-10H3,(H,24,25) |
| InChIKey | XTUNPJQKTNXBME-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|