C16H23NO8 — CID 57251984
[(1S,2R,8R,8aR)-1,2-diacetyloxy-1-ethoxy-5-oxo-2,3,6,7,8,8a-hexahydroindolizin-8-yl] acetate (PubChem CID 57251984) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is [(1S,2R,8R,8aR)-1,2-diacetyloxy-1-ethoxy-5-oxo-2,3,6,7,8,8a-hexahydroindolizin-8-yl] acetate.
| Compound Name | [(1S,2R,8R,8aR)-1,2-diacetyloxy-1-ethoxy-5-oxo-2,3,6,7,8,8a-hexahydroindolizin-8-yl] acetate |
|---|---|
| PubChem CID | 57251984 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [(1S,2R,8R,8aR)-1,2-diacetyloxy-1-ethoxy-5-oxo-2,3,6,7,8,8a-hexahydroindolizin-8-yl] acetate |
| SMILES | CCO[C@@]1(OC(C)=O)[C@H](OC(C)=O)CN2C(=O)CC[C@@H](OC(C)=O)[C@@H]21 |
| InChI | InChI=1S/C16H23NO8/c1-5-22-16(25-11(4)20)13(24-10(3)19)8-17-14(21)7-6-12(15(16)17)23-9(2)18/h12-13,15H,5-8H2,1-4H3/t12-,13-,15-,16-/m1/s1 |
| InChIKey | BSFLPEDNSLTCPC-RRCSTGOVSA-N |
| XLogP | 0.15 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|