C15H28S2 — CID 57252280
6,8,10-trimethyldodeca-2,11-diene-1,5-dithiol (PubChem CID 57252280) has the molecular formula C15H28S2 and a molecular weight of 272.52 g/mol. Its IUPAC name is 6,8,10-trimethyldodeca-2,11-diene-1,5-dithiol.
| Compound Name | 6,8,10-trimethyldodeca-2,11-diene-1,5-dithiol |
|---|---|
| PubChem CID | 57252280 |
| Molecular Formula | C15H28S2 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 6,8,10-trimethyldodeca-2,11-diene-1,5-dithiol |
| SMILES | C=CC(C)CC(C)CC(C)C(S)CC=CCS |
| InChI | InChI=1S/C15H28S2/c1-5-12(2)10-13(3)11-14(4)15(17)8-6-7-9-16/h5-7,12-17H,1,8-11H2,2-4H3 |
| InChIKey | CVWZPRLDKHPLTM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|