C13H20N4O6S — CID 57252650
tert-butyl N-[(2S)-1-(2-nitrooxyethylamino)-1-oxo-3-(1,3-thiazol-4-yl)propan-2-yl]carbamate (PubChem CID 57252650) has the molecular formula C13H20N4O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-nitrooxyethylamino)-1-oxo-3-(1,3-thiazol-4-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-nitrooxyethylamino)-1-oxo-3-(1,3-thiazol-4-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 57252650 |
| Molecular Formula | C13H20N4O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-nitrooxyethylamino)-1-oxo-3-(1,3-thiazol-4-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cscn1)C(=O)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O6S/c1-13(2,3)23-12(19)16-10(6-9-7-24-8-15-9)11(18)14-4-5-22-17(20)21/h7-8,10H,4-6H2,1-3H3,(H,14,18)(H,16,19)/t10-/m0/s1 |
| InChIKey | LZRRNHWNKYZGJP-JTQLQIEISA-N |
| XLogP | 0.90 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|