C21H15F4N3O2S — CID 57252677
7-(3-aminocyclopentyl)-9-(2,4-difluorophenyl)-6,8-difluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 57252677) has the molecular formula C21H15F4N3O2S and a molecular weight of 449.43 g/mol. Its IUPAC name is 7-(3-aminocyclopentyl)-9-(2,4-difluorophenyl)-6,8-difluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 7-(3-aminocyclopentyl)-9-(2,4-difluorophenyl)-6,8-difluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 57252677 |
| Molecular Formula | C21H15F4N3O2S |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 7-(3-aminocyclopentyl)-9-(2,4-difluorophenyl)-6,8-difluoro-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | NC1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)cc4F)c3c2F)C1 |
| InChI | InChI=1S/C21H15F4N3O2S/c22-9-2-4-14(12(23)6-9)28-18-11(19(29)16-20(30)27-31-21(16)28)7-13(24)15(17(18)25)8-1-3-10(26)5-8/h2,4,6-8,10H,1,3,5,26H2,(H,27,30) |
| InChIKey | YBOZMHSLJIAEEB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |