C27H18N6O12 — CID 57252878
5-[[4,6-bis(3,5-dicarboxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 57252878) has the molecular formula C27H18N6O12 and a molecular weight of 618.47 g/mol. Its IUPAC name is 5-[[4,6-bis(3,5-dicarboxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4,6-bis(3,5-dicarboxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 57252878 |
| Molecular Formula | C27H18N6O12 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 5-[[4,6-bis(3,5-dicarboxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Nc2nc(Nc3cc(C(=O)O)cc(C(=O)O)c3)nc(Nc3cc(C(=O)O)cc(C(=O)O)c3)n2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C27H18N6O12/c34-19(35)10-1-11(20(36)37)5-16(4-10)28-25-31-26(29-17-6-12(21(38)39)2-13(7-17)22(40)41)33-27(32-25)30-18-8-14(23(42)43)3-15(9-18)24(44)45/h1-9H,(H,34,35)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)(H3,28,29,30,31,32,33) |
| InChIKey | DHLQCTZKYCWGKN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 298.56 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |