C16H20O4 — CID 57253556
1-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pent-3-en-2-yl acetate (PubChem CID 57253556) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pent-3-en-2-yl acetate.
| Compound Name | 1-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pent-3-en-2-yl acetate |
|---|---|
| PubChem CID | 57253556 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)pent-3-en-2-yl acetate |
| SMILES | CC=CC(CC1=C(C)C(=O)C(C)=C(C)C1=O)OC(C)=O |
| InChI | InChI=1S/C16H20O4/c1-6-7-13(20-12(5)17)8-14-11(4)15(18)9(2)10(3)16(14)19/h6-7,13H,8H2,1-5H3 |
| InChIKey | XCJYTJHLDNBVKX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|