About 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione
3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione (PubChem CID 57253799) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione.
Molecular Properties
| Compound Name | 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione |
| PubChem CID | 57253799 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione |
| SMILES | C=CC1(C2C(=O)C(=O)c3ccccc3C2=O)CCCCC1 |
| InChI | InChI=1S/C18H18O3/c1-2-18(10-6-3-7-11-18)14-15(19)12-8-4-5-9-13(12)16(20)17(14)21/h2,4-5,8-9,14H,1,3,6-7,10-11H2 |
| InChIKey | ZKPFSTDPELVXBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione?
The IUPAC name of 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione (CID 57253799) is 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione.
What is the SMILES notation for 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione?
The canonical SMILES for 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione is C=CC1(C2C(=O)C(=O)c3ccccc3C2=O)CCCCC1.
What is the InChIKey of 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione?
The InChIKey is ZKPFSTDPELVXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-2-18(10-6-3-7-11-18)14-15(19)12-8-4-5-9-13(12)16(20)17(14)21/h2,4-5,8-9,14H,1,3,6-7,10-11H2.
What are the key properties of 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione?
3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione has a molecular weight of 282.34 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethenylcyclohexyl)naphthalene-1,2,4-trione is sourced from PubChem (CID 57253799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).