C42H37F5N4O2+2 — CID 57253980
4-[4-[3-(5-fluoro-1-benzofuran-3-yl)propyl]-1-(1H-indol-4-yl)-4-[2-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)ethyl]piperazine-1,4-diium-1-yl]-1H-indole (PubChem CID 57253980) has the molecular formula C42H37F5N4O2+2 and a molecular weight of 724.77 g/mol. Its IUPAC name is 4-[4-[3-(5-fluoro-1-benzofuran-3-yl)propyl]-1-(1H-indol-4-yl)-4-[2-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)ethyl]piperazine-1,4-diium-1-yl]-1H-indole.
| Compound Name | 4-[4-[3-(5-fluoro-1-benzofuran-3-yl)propyl]-1-(1H-indol-4-yl)-4-[2-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)ethyl]piperazine-1,4-diium-1-yl]-1H-indole |
|---|---|
| PubChem CID | 57253980 |
| Molecular Formula | C42H37F5N4O2+2 |
| Molecular Weight | 724.77 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | 4-[4-[3-(5-fluoro-1-benzofuran-3-yl)propyl]-1-(1H-indol-4-yl)-4-[2-(4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-yl)ethyl]piperazine-1,4-diium-1-yl]-1H-indole |
| SMILES | Cc1oc2c(F)c(F)c(F)c(F)c2c1CC[N+]1(CCCc2coc3ccc(F)cc23)CC[N+](c2cccc3[nH]ccc23)(c2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C42H37F5N4O2/c1-25-28(37-38(44)39(45)40(46)41(47)42(37)53-25)14-18-50(17-4-5-26-24-52-36-11-10-27(43)23-31(26)36)19-21-51(22-20-50,34-8-2-6-32-29(34)12-15-48-32)35-9-3-7-33-30(35)13-16-49-33/h2-3,6-13,15-16,23-24,48-49H,4-5,14,17-22H2,1H3/q+2 |
| InChIKey | QVNLLNUJZXZTMB-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.77 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|