About CID 57254568
CID 57254568 (PubChem CID 57254568) has the molecular formula C3H6ClOSi
and a molecular weight of 121.62 g/mol.
Molecular Properties
| Compound Name | CID 57254568 |
| PubChem CID | 57254568 |
| Molecular Formula | C3H6ClOSi |
| Molecular Weight | 121.62 g/mol |
| Exact Mass | 120.99 |
| IUPAC Name | — |
| SMILES | CCC(Cl)O[Si] |
| InChI | InChI=1S/C3H6ClOSi/c1-2-3(4)5-6/h3H,2H2,1H3 |
| InChIKey | KVWSNTVOGOQBPK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.62 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57254568 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57254568?
The IUPAC name of CID 57254568 (CID 57254568) is not available.
What is the SMILES notation for CID 57254568?
The canonical SMILES for CID 57254568 is CCC(Cl)O[Si].
What is the InChIKey of CID 57254568?
The InChIKey is KVWSNTVOGOQBPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6ClOSi/c1-2-3(4)5-6/h3H,2H2,1H3.
What are the key properties of CID 57254568?
CID 57254568 has a molecular weight of 121.62 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57254568 is sourced from PubChem (CID 57254568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).