About [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene
[[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene (PubChem CID 57254583) has the molecular formula C27H24N2
and a molecular weight of 376.50 g/mol. Its IUPAC name is [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene.
Molecular Properties
| Compound Name | [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene |
| PubChem CID | 57254583 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene |
| SMILES | [H]/N=N/C(c1ccccc1)c1cccc(-c2ccc(C)cc2)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C27H24N2/c1-19-11-15-21(16-12-19)24-9-6-10-25(26(24)22-17-13-20(2)14-18-22)27(29-28)23-7-4-3-5-8-23/h3-18,27-28H,1-2H3/b29-28+ |
| InChIKey | OZGAKHFRAVRCFR-ZQHSETAFSA-N |
| XLogP | 7.76 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene?
The IUPAC name of [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene (CID 57254583) is [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene.
What is the SMILES notation for [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene?
The canonical SMILES for [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene is [H]/N=N/C(c1ccccc1)c1cccc(-c2ccc(C)cc2)c1-c1ccc(C)cc1.
What is the InChIKey of [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene?
The InChIKey is OZGAKHFRAVRCFR-ZQHSETAFSA-N. The full InChI is InChI=1S/C27H24N2/c1-19-11-15-21(16-12-19)24-9-6-10-25(26(24)22-17-13-20(2)14-18-22)27(29-28)23-7-4-3-5-8-23/h3-18,27-28H,1-2H3/b29-28+.
What are the key properties of [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene?
[[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene has a molecular weight of 376.50 g/mol, XLogP of 7.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,3-bis(4-methylphenyl)phenyl]-phenylmethyl]diazene is sourced from PubChem (CID 57254583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).