C12H20N6O3PS2+ — CID 57255242
bis[3-methylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium (PubChem CID 57255242) has the molecular formula C12H20N6O3PS2+ and a molecular weight of 391.44 g/mol. Its IUPAC name is bis[3-methylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium.
| Compound Name | bis[3-methylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57255242 |
| Molecular Formula | C12H20N6O3PS2+ |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | bis[3-methylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
| SMILES | CSC(CCO[P+](=O)OCCC(SC)c1ncn[nH]1)c1ncn[nH]1 |
| InChI | InChI=1S/C12H20N6O3PS2/c1-23-9(11-13-7-15-17-11)3-5-20-22(19)21-6-4-10(24-2)12-14-8-16-18-12/h7-10H,3-6H2,1-2H3,(H,13,15,17)(H,14,16,18)/q+1 |
| InChIKey | XQJRRYTTZIDGCR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|