C21H23NO7S2 — CID 57255569
3-[5-[3-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 57255569) has the molecular formula C21H23NO7S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[5-[3-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[5-[3-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57255569 |
| Molecular Formula | C21H23NO7S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 3-[5-[3-[3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | COc1cc(C=CC=C2SC(=S)N(CCC(=O)O)C2=O)ccc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H23NO7S2/c1-21(2,3)29-20(26)28-14-9-8-13(12-15(14)27-4)6-5-7-16-18(25)22(19(30)31-16)11-10-17(23)24/h5-9,12H,10-11H2,1-4H3,(H,23,24) |
| InChIKey | WNTHDUFXOSNMGQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|