C17H28N2O4 — CID 57255690
3-(2-methoxyethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 57255690) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 3-(2-methoxyethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 57255690 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-(2-methoxyethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COCCC1CN(Cc2cc(OC)c(OC)c(OC)c2)CCN1 |
| InChI | InChI=1S/C17H28N2O4/c1-20-8-5-14-12-19(7-6-18-14)11-13-9-15(21-2)17(23-4)16(10-13)22-3/h9-10,14,18H,5-8,11-12H2,1-4H3 |
| InChIKey | BMGHSTRSOIDGKR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |