About trimethoxysilyl 2-methylhex-2-enoate
trimethoxysilyl 2-methylhex-2-enoate (PubChem CID 57255707) has the molecular formula C10H20O5Si
and a molecular weight of 248.35 g/mol. Its IUPAC name is trimethoxysilyl 2-methylhex-2-enoate.
Molecular Properties
| Compound Name | trimethoxysilyl 2-methylhex-2-enoate |
| PubChem CID | 57255707 |
| Molecular Formula | C10H20O5Si |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | trimethoxysilyl 2-methylhex-2-enoate |
| SMILES | CCCC=C(C)C(=O)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H20O5Si/c1-6-7-8-9(2)10(11)15-16(12-3,13-4)14-5/h8H,6-7H2,1-5H3 |
| InChIKey | CLCMTDPVKAALLC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trimethoxysilyl 2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxysilyl 2-methylhex-2-enoate?
The IUPAC name of trimethoxysilyl 2-methylhex-2-enoate (CID 57255707) is trimethoxysilyl 2-methylhex-2-enoate.
What is the SMILES notation for trimethoxysilyl 2-methylhex-2-enoate?
The canonical SMILES for trimethoxysilyl 2-methylhex-2-enoate is CCCC=C(C)C(=O)O[Si](OC)(OC)OC.
What is the InChIKey of trimethoxysilyl 2-methylhex-2-enoate?
The InChIKey is CLCMTDPVKAALLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si/c1-6-7-8-9(2)10(11)15-16(12-3,13-4)14-5/h8H,6-7H2,1-5H3.
What are the key properties of trimethoxysilyl 2-methylhex-2-enoate?
trimethoxysilyl 2-methylhex-2-enoate has a molecular weight of 248.35 g/mol, XLogP of 1.65, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxysilyl 2-methylhex-2-enoate is sourced from PubChem (CID 57255707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).