About bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate
bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate (PubChem CID 57255850) has the molecular formula C18H24N2O8S4
and a molecular weight of 524.66 g/mol. Its IUPAC name is bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate.
Molecular Properties
| Compound Name | bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate |
| PubChem CID | 57255850 |
| Molecular Formula | C18H24N2O8S4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate |
| SMILES | Cc1ncc(CS)c(CO)c1OS(=O)(=O)CCS(=O)(=O)Oc1c(C)ncc(CS)c1CO |
| InChI | InChI=1S/C18H24N2O8S4/c1-11-17(15(7-21)13(9-29)5-19-11)27-31(23,24)3-4-32(25,26)28-18-12(2)20-6-14(10-30)16(18)8-22/h5-6,21-22,29-30H,3-4,7-10H2,1-2H3 |
| InChIKey | WATWPOCZNPAEDL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate?
The IUPAC name of bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate (CID 57255850) is bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate.
What is the SMILES notation for bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate?
The canonical SMILES for bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate is Cc1ncc(CS)c(CO)c1OS(=O)(=O)CCS(=O)(=O)Oc1c(C)ncc(CS)c1CO.
What is the InChIKey of bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate?
The InChIKey is WATWPOCZNPAEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O8S4/c1-11-17(15(7-21)13(9-29)5-19-11)27-31(23,24)3-4-32(25,26)28-18-12(2)20-6-14(10-30)16(18)8-22/h5-6,21-22,29-30H,3-4,7-10H2,1-2H3.
What are the key properties of bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate?
bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate has a molecular weight of 524.66 g/mol, XLogP of 1.06, 11 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(hydroxymethyl)-2-methyl-5-(sulfanylmethyl)-3-pyridinyl] ethane-1,2-disulfonate is sourced from PubChem (CID 57255850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).