About 5-amino-2,5-dihydropyran-6-one
5-amino-2,5-dihydropyran-6-one (PubChem CID 57255938) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-amino-2,5-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-amino-2,5-dihydropyran-6-one |
| PubChem CID | 57255938 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 5-amino-2,5-dihydropyran-6-one |
| SMILES | NC1C=CCOC1=O |
| InChI | InChI=1S/C5H7NO2/c6-4-2-1-3-8-5(4)7/h1-2,4H,3,6H2 |
| InChIKey | AUXDCVDCKOREEJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,5-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,5-dihydropyran-6-one?
The IUPAC name of 5-amino-2,5-dihydropyran-6-one (CID 57255938) is 5-amino-2,5-dihydropyran-6-one.
What is the SMILES notation for 5-amino-2,5-dihydropyran-6-one?
The canonical SMILES for 5-amino-2,5-dihydropyran-6-one is NC1C=CCOC1=O.
What is the InChIKey of 5-amino-2,5-dihydropyran-6-one?
The InChIKey is AUXDCVDCKOREEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c6-4-2-1-3-8-5(4)7/h1-2,4H,3,6H2.
What are the key properties of 5-amino-2,5-dihydropyran-6-one?
5-amino-2,5-dihydropyran-6-one has a molecular weight of 113.12 g/mol, XLogP of -0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,5-dihydropyran-6-one is sourced from PubChem (CID 57255938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).