C18H30O3 — CID 57255946
(2S,3R,4S,5S)-2-(4,8-dimethylnona-1,3,7-trienyl)-4-methoxy-5-methyloxan-3-ol (PubChem CID 57255946) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-(4,8-dimethylnona-1,3,7-trienyl)-4-methoxy-5-methyloxan-3-ol.
| Compound Name | (2S,3R,4S,5S)-2-(4,8-dimethylnona-1,3,7-trienyl)-4-methoxy-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 57255946 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2S,3R,4S,5S)-2-(4,8-dimethylnona-1,3,7-trienyl)-4-methoxy-5-methyloxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](C=CC=C(C)CCC=C(C)C)OC[C@@H]1C |
| InChI | InChI=1S/C18H30O3/c1-13(2)8-6-9-14(3)10-7-11-16-17(19)18(20-5)15(4)12-21-16/h7-8,10-11,15-19H,6,9,12H2,1-5H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | LFEOKULOWKGMCI-XSLAGTTESA-N |
| XLogP | 3.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|