About methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate
methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (PubChem CID 57256086) has the molecular formula C23H40O5
and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
Molecular Properties
| Compound Name | methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| PubChem CID | 57256086 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| SMILES | CCO[C@H]1CCC(O)(CCCCC=CC(=O)OC)[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C23H40O5/c1-3-28-21-16-18-23(26,17-12-8-7-11-15-22(25)27-2)20(21)14-10-6-4-5-9-13-19-24/h10-11,14-15,20-21,24,26H,3-9,12-13,16-19H2,1-2H3/t20-,21+,23?/m1/s1 |
| InChIKey | QVCQQMPMKXZYQP-VXVSGHKGSA-N |
| XLogP | 4.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The IUPAC name of methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (CID 57256086) is methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
What is the SMILES notation for methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The canonical SMILES for methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is CCO[C@H]1CCC(O)(CCCCC=CC(=O)OC)[C@@H]1C=CCCCCCCO.
What is the InChIKey of methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The InChIKey is QVCQQMPMKXZYQP-VXVSGHKGSA-N. The full InChI is InChI=1S/C23H40O5/c1-3-28-21-16-18-23(26,17-12-8-7-11-15-22(25)27-2)20(21)14-10-6-4-5-9-13-19-24/h10-11,14-15,20-21,24,26H,3-9,12-13,16-19H2,1-2H3/t20-,21+,23?/m1/s1.
What are the key properties of methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate has a molecular weight of 396.57 g/mol, XLogP of 4.32, 15 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(2R,3S)-3-ethoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is sourced from PubChem (CID 57256086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).