C36H48O4 — CID 57256162
11-[(7S,13S)-2-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]undec-10-enoic acid (PubChem CID 57256162) has the molecular formula C36H48O4 and a molecular weight of 544.78 g/mol. Its IUPAC name is 11-[(7S,13S)-2-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]undec-10-enoic acid.
| Compound Name | 11-[(7S,13S)-2-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]undec-10-enoic acid |
|---|---|
| PubChem CID | 57256162 |
| Molecular Formula | C36H48O4 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 11-[(7S,13S)-2-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]undec-10-enoic acid |
| SMILES | C[C@@]12CCCC1C1C(C=CCCCCCCCCC(=O)O)Cc3cc(OCc4ccccc4)c(O)cc3C1CC2 |
| InChI | InChI=1S/C36H48O4/c1-36-20-13-17-31(36)35-27(16-11-6-4-2-3-5-7-12-18-34(38)39)22-28-23-33(40-25-26-14-9-8-10-15-26)32(37)24-30(28)29(35)19-21-36/h8-11,14-16,23-24,27,29,31,35,37H,2-7,12-13,17-22,25H2,1H3,(H,38,39)/t27?,29?,31?,35?,36-/m0/s1 |
| InChIKey | JGFXFZDSGJWSKI-JELFGXDTSA-N |
| XLogP | 9.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|