C14H20F3N2O4S+ — CID 57256214
(2R)-1-[2-[(1-aminocyclopropanecarbonyl)sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57256214) has the molecular formula C14H20F3N2O4S+ and a molecular weight of 369.39 g/mol. Its IUPAC name is (2R)-1-[2-[(1-aminocyclopropanecarbonyl)sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-[(1-aminocyclopropanecarbonyl)sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57256214 |
| Molecular Formula | C14H20F3N2O4S+ |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2R)-1-[2-[(1-aminocyclopropanecarbonyl)sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(CSC(=O)C1(N)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O4S/c1-8-3-2-6-19(8,12(22)23)10(20)9(14(15,16)17)7-24-11(21)13(18)4-5-13/h8-9H,2-7,18H2,1H3/p+1/t8-,9?,19?/m1/s1 |
| InChIKey | GOLGZCCXTGMHNU-PEXBRIMZSA-O |
| XLogP | 2.12 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|