C31H31N3O3 — CID 57256945
N-[7-[(6-carbamimidoylnaphthalen-1-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3-methoxyphenyl)acetamide (PubChem CID 57256945) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[7-[(6-carbamimidoylnaphthalen-1-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[7-[(6-carbamimidoylnaphthalen-1-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 57256945 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-[7-[(6-carbamimidoylnaphthalen-1-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3-methoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc2c(COc3ccc4c(c3)C(NC(=O)Cc3cccc(OC)c3)CCC4)cccc2c1 |
| InChI | InChI=1S/C31H31N3O3/c1-36-25-9-2-5-20(15-25)16-30(35)34-29-10-4-6-21-11-13-26(18-28(21)29)37-19-24-8-3-7-22-17-23(31(32)33)12-14-27(22)24/h2-3,5,7-9,11-15,17-18,29H,4,6,10,16,19H2,1H3,(H3,32,33)(H,34,35) |
| InChIKey | VVMMVQCVEPMYGZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|