C18H24BN2O6S2 — CID 57257139
CID 57257139 (PubChem CID 57257139) has the molecular formula C18H24BN2O6S2 and a molecular weight of 439.34 g/mol.
| Compound Name | CID 57257139 |
|---|---|
| PubChem CID | 57257139 |
| Molecular Formula | C18H24BN2O6S2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | — |
| SMILES | CCCNS(=O)(=O)c1ccc(O[B]Oc2ccc(S(=O)(=O)NCCC)cc2)cc1 |
| InChI | InChI=1S/C18H24BN2O6S2/c1-3-13-20-28(22,23)17-9-5-15(6-10-17)26-19-27-16-7-11-18(12-8-16)29(24,25)21-14-4-2/h5-12,20-21H,3-4,13-14H2,1-2H3 |
| InChIKey | SVCSOFOQGSWEKV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|