C25H39N3O3 — CID 57257206
N'-cyclohexyl-N'-[2-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]ethyl]-N-methylpropanediamide (PubChem CID 57257206) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is N'-cyclohexyl-N'-[2-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]ethyl]-N-methylpropanediamide.
| Compound Name | N'-cyclohexyl-N'-[2-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]ethyl]-N-methylpropanediamide |
|---|---|
| PubChem CID | 57257206 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | N'-cyclohexyl-N'-[2-[(3R,4S)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]ethyl]-N-methylpropanediamide |
| SMILES | CNC(=O)CC(=O)N(CCN1CC[C@](C)(c2cccc(O)c2)[C@@H](C)C1)C1CCCCC1 |
| InChI | InChI=1S/C25H39N3O3/c1-19-18-27(13-12-25(19,2)20-8-7-11-22(29)16-20)14-15-28(21-9-5-4-6-10-21)24(31)17-23(30)26-3/h7-8,11,16,19,21,29H,4-6,9-10,12-15,17-18H2,1-3H3,(H,26,30)/t19-,25-/m0/s1 |
| InChIKey | FVHYQANWTOAJRG-DFBJGRDBSA-N |
| XLogP | 3.29 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|