C18H33NO6 — CID 57257242
N-[(2S,3S,4R,5R,6R)-2-dec-9-enoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 57257242) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R,6R)-2-dec-9-enoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5R,6R)-2-dec-9-enoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 57257242 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[(2S,3S,4R,5R,6R)-2-dec-9-enoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | C=CCCCCCCCCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C18H33NO6/c1-3-4-5-6-7-8-9-10-11-24-18-15(19-13(2)21)17(23)16(22)14(12-20)25-18/h3,14-18,20,22-23H,1,4-12H2,2H3,(H,19,21)/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | XDDJEKKBWJXVQW-ICUGJSFKSA-N |
| XLogP | 0.86 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|