About 3-(chloromethoxy)-1,1-dinitropropane
3-(chloromethoxy)-1,1-dinitropropane (PubChem CID 57257296) has the molecular formula C4H7ClN2O5
and a molecular weight of 198.56 g/mol. Its IUPAC name is 3-(chloromethoxy)-1,1-dinitropropane.
Molecular Properties
| Compound Name | 3-(chloromethoxy)-1,1-dinitropropane |
| PubChem CID | 57257296 |
| Molecular Formula | C4H7ClN2O5 |
| Molecular Weight | 198.56 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 3-(chloromethoxy)-1,1-dinitropropane |
| SMILES | O=[N+]([O-])C(CCOCCl)[N+](=O)[O-] |
| InChI | InChI=1S/C4H7ClN2O5/c5-3-12-2-1-4(6(8)9)7(10)11/h4H,1-3H2 |
| InChIKey | ROYNWPZYACBALH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.56 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethoxy)-1,1-dinitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethoxy)-1,1-dinitropropane?
The IUPAC name of 3-(chloromethoxy)-1,1-dinitropropane (CID 57257296) is 3-(chloromethoxy)-1,1-dinitropropane.
What is the SMILES notation for 3-(chloromethoxy)-1,1-dinitropropane?
The canonical SMILES for 3-(chloromethoxy)-1,1-dinitropropane is O=[N+]([O-])C(CCOCCl)[N+](=O)[O-].
What is the InChIKey of 3-(chloromethoxy)-1,1-dinitropropane?
The InChIKey is ROYNWPZYACBALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClN2O5/c5-3-12-2-1-4(6(8)9)7(10)11/h4H,1-3H2.
What are the key properties of 3-(chloromethoxy)-1,1-dinitropropane?
3-(chloromethoxy)-1,1-dinitropropane has a molecular weight of 198.56 g/mol, XLogP of 0.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethoxy)-1,1-dinitropropane is sourced from PubChem (CID 57257296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).