C17H30O3 — CID 57257313
(3S,4S,5R,8S)-4-methoxy-5-methyl-8-non-1-enyl-1,7-dioxaspiro[2.5]octane (PubChem CID 57257313) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (3S,4S,5R,8S)-4-methoxy-5-methyl-8-non-1-enyl-1,7-dioxaspiro[2.5]octane.
| Compound Name | (3S,4S,5R,8S)-4-methoxy-5-methyl-8-non-1-enyl-1,7-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 57257313 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3S,4S,5R,8S)-4-methoxy-5-methyl-8-non-1-enyl-1,7-dioxaspiro[2.5]octane |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@@H](C)[C@H](OC)[C@@]12CO2 |
| InChI | InChI=1S/C17H30O3/c1-4-5-6-7-8-9-10-11-15-17(13-20-17)16(18-3)14(2)12-19-15/h10-11,14-16H,4-9,12-13H2,1-3H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | IORQSAAHJVVMSQ-LTIDMASMSA-N |
| XLogP | 3.72 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|