C16H32OSi — CID 57257483
[(3aR,4S,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57257483) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is [(3aR,4S,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57257483 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [(3aR,4S,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C16H32OSi/c1-15(2,3)18(5,6)17-14-10-8-12-16(4)11-7-9-13(14)16/h13-14H,7-12H2,1-6H3/t13-,14-,16+/m0/s1 |
| InChIKey | GAPKPVKZRDFVNG-OFQRWUPVSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|