C21H22S — CID 57257554
2-(2-cyclobutyl-3-naphthalen-2-ylpropyl)thiophene (PubChem CID 57257554) has the molecular formula C21H22S and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-(2-cyclobutyl-3-naphthalen-2-ylpropyl)thiophene.
| Compound Name | 2-(2-cyclobutyl-3-naphthalen-2-ylpropyl)thiophene |
|---|---|
| PubChem CID | 57257554 |
| Molecular Formula | C21H22S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(2-cyclobutyl-3-naphthalen-2-ylpropyl)thiophene |
| SMILES | c1csc(CC(Cc2ccc3ccccc3c2)C2CCC2)c1 |
| InChI | InChI=1S/C21H22S/c1-2-6-19-13-16(10-11-18(19)5-1)14-20(17-7-3-8-17)15-21-9-4-12-22-21/h1-2,4-6,9-13,17,20H,3,7-8,14-15H2 |
| InChIKey | UBBZANMISGSYKG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |