C31H54O — CID 57257569
24-methoxy-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18-pentaene (PubChem CID 57257569) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is 24-methoxy-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18-pentaene.
| Compound Name | 24-methoxy-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 57257569 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | 24-methoxy-2,6,10,14,18,22-hexamethyltetracosa-2,6,10,14,18-pentaene |
| SMILES | COCCC(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C31H54O/c1-26(2)14-9-15-27(3)16-10-17-28(4)18-11-19-29(5)20-12-21-30(6)22-13-23-31(7)24-25-32-8/h14,16,18,20,22,31H,9-13,15,17,19,21,23-25H2,1-8H3 |
| InChIKey | RLSFHLCRVIATMO-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|