C28H39N3OSSi — CID 57257829
[(3R,5S)-1-benzyl-5-[(3-methylimidazol-4-yl)-phenylsulfanylmethyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57257829) has the molecular formula C28H39N3OSSi and a molecular weight of 493.79 g/mol. Its IUPAC name is [(3R,5S)-1-benzyl-5-[(3-methylimidazol-4-yl)-phenylsulfanylmethyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5S)-1-benzyl-5-[(3-methylimidazol-4-yl)-phenylsulfanylmethyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57257829 |
| Molecular Formula | C28H39N3OSSi |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | [(3R,5S)-1-benzyl-5-[(3-methylimidazol-4-yl)-phenylsulfanylmethyl]pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | Cn1cncc1C(Sc1ccccc1)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C28H39N3OSSi/c1-28(2,3)34(5,6)32-23-17-25(31(20-23)19-22-13-9-7-10-14-22)27(26-18-29-21-30(26)4)33-24-15-11-8-12-16-24/h7-16,18,21,23,25,27H,17,19-20H2,1-6H3/t23-,25+,27?/m1/s1 |
| InChIKey | JUJDDMDMSUMYIY-XYLRWGSLSA-N |
| XLogP | 6.92 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|