C31H37ClN3O3+ — CID 57257869
[6-chloro-1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-(4-methoxy-2,6-dimethylbenzoyl)-di(propan-2-yl)azanium (PubChem CID 57257869) has the molecular formula C31H37ClN3O3+ and a molecular weight of 535.11 g/mol. Its IUPAC name is [6-chloro-1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-(4-methoxy-2,6-dimethylbenzoyl)-di(propan-2-yl)azanium.
| Compound Name | [6-chloro-1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-(4-methoxy-2,6-dimethylbenzoyl)-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 57257869 |
| Molecular Formula | C31H37ClN3O3+ |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [6-chloro-1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-(4-methoxy-2,6-dimethylbenzoyl)-di(propan-2-yl)azanium |
| SMILES | COc1ccc(-n2c(C[N+](C(=O)c3c(C)cc(OC)cc3C)(C(C)C)C(C)C)nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C31H37ClN3O3/c1-19(2)35(20(3)4,31(36)30-21(5)15-26(38-8)16-22(30)6)18-29-33-27-14-9-23(32)17-28(27)34(29)24-10-12-25(37-7)13-11-24/h9-17,19-20H,18H2,1-8H3/q+1 |
| InChIKey | SURFFKYXLURXFU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|